HOMEPRODUCTSSERVICESCOMPANYCONTACTFAQResearchDictionaryPharmaMobileSign Up FREE or Login

Osmium

Osmium. A very hard, gray, toxic, and nearly infusible metal element, atomic number 76, atomic weight 190.2, symbol Os. (From Dorland, 28th ed)
Networked: 82 relevant articles (1 outcomes, 11 trials/studies)

Relationship Network

Bio-Agent Context: Research Results

Experts

1. Sadler, Peter J: 7 articles (05/2014 - 03/2007)
2. Arion, Vladimir B: 5 articles (09/2015 - 08/2008)
3. van Rijt, Sabine H: 4 articles (05/2014 - 02/2009)
4. Keppler, Bernhard K: 4 articles (11/2012 - 08/2008)
5. Jakupec, Michael A: 4 articles (11/2012 - 08/2008)
6. Fu, Ying: 3 articles (05/2014 - 11/2010)
7. Bruno, Peter M: 2 articles (10/2014 - 09/2013)
8. Suntharalingam, Kogularamanan: 2 articles (10/2014 - 09/2013)
9. Lin, Wei: 2 articles (10/2014 - 09/2013)
10. Lippard, Stephen J: 2 articles (10/2014 - 09/2013)

Related Diseases

1. Dehydration (Water Stress)
2. Neoplasms (Cancer)
3. Carcinoma (Carcinomatosis)
01/01/2013 - "A novel Osmium-based compound targets the mitochondria and triggers ROS-dependent apoptosis in colon carcinoma."
06/01/2009 - "A study into the possible molecular targets of the osmium carbonyl cluster Os(3)(CO)(10)(NCCH(3))(2) (2) in the ER- breast carcinoma (MDA-MB-231) cell line was carried out. "
08/01/2008 - "Osmium carbonyl clusters, especially the cluster [Os(3)(CO)(10)(NCCH(3))(2)], were found to be active against four cancer cell lines, namely, ER+ breast carcinoma (MCF-7), ER- breast carcinoma (MDA-MB-231), metastatic colorectal adenocarcinoma (SW620), and hepatocarcinoma (Hep G2). "
01/28/2010 - "The cytotoxicity, hydrophobicity (log P), cellular uptake, aqueous reactivity, and extent of DNA adduct formation in the A2780 ovarian carcinoma cells for four osmium(II) arene complexes [(eta(6)-arene)Os(4-methyl-picolinate)Cl] that differ only in their arene ligands as benzene (1), p-cymene (2), biphenyl (3), or tetrahydroanthracene (4) are reported. "
01/01/2010 - "We have compared the organometallic arene complexes [(eta(6)-biphenyl)M(ethylenediamine)Cl](+) RM175 (M=Ru(II)) and its isostructural osmium(II) analogue AFAP51 (M=Os(II)) for their ability to induce cell detachment resistance from fibronectin, collagen IV and poly-l-lysine, and cell re-adhesion after treatment, their effects on cell migration and cell viability, on matrix metalloproteinases production, and on primary tumour growth of MCa mammary carcinoma, the effect of human serum albumin on their cytotoxicity. "
4. Ovarian Neoplasms (Ovarian Cancer)
5. Ischemia

Related Drugs and Biologics

1. Glutaral (Glutaraldehyde)
2. Ethanol (Ethyl Alcohol)
3. propylene oxide
4. Ligands
5. Ruthenium
6. diphenyl (biphenyl)
7. 4-cymene (p-cymene)
8. Carbon Monoxide
9. Aldehydes
10. hexacyanoferrate II (ferrocyanide)

Related Therapies and Procedures

1. Subcutaneous Injections
2. Intra-Articular Injections
3. Electrodes (Electrode)
4. Aftercare (After-Treatment)