HOMEPRODUCTSCOMPANYCONTACTFAQResearchDictionaryPharmaSign Up FREE or Login

Chloroquine (Aralen)

The prototypical antimalarial agent with a mechanism that is not well understood. It has also been used to treat rheumatoid arthritis, systemic lupus erythematosus, and in the systemic therapy of amebic liver abscesses.
Also Known As:
Aralen; Arechine; Arequin; Chingamin; Chlorochin; Chloroquine Sulfate; Chloroquine Sulphate; Khingamin; Nivaquine; Sulfate, Chloroquine; Sulphate, Chloroquine; 1,4-Pentanediamine, N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-
Networked: 7498 relevant articles (818 outcomes, 887 trials/studies)

Relationship Network

Drug Context: Research Results

Experts

1. White, Nicholas J: 42 articles (10/2022 - 03/2002)
2. Price, Ric N: 23 articles (10/2019 - 10/2007)
3. Sowunmi, A: 20 articles (01/2008 - 04/2000)
4. Anstey, Nicholas M: 19 articles (01/2021 - 07/2002)
5. Plowe, Christopher V: 19 articles (01/2021 - 10/2002)
6. Baird, J Kevin: 19 articles (07/2020 - 03/2002)
7. Nosten, François: 18 articles (10/2021 - 03/2002)
8. Fidock, David A: 18 articles (12/2019 - 10/2002)
9. Sauerwein, Robert W: 18 articles (01/2019 - 03/2005)
10. Smith, Peter J: 17 articles (02/2020 - 05/2004)

Related Diseases

1. Malaria
2. Falciparum Malaria (Plasmodium falciparum Malaria)
3. Infections
4. Vivax Malaria
5. COVID-19

Related Drugs and Biologics

1. pyrimethamine drug combination fanasil (Fansidar)
2. Antimalarials (Antimalarial Agents)
3. Hydroxychloroquine (Plaquenil)
4. Amodiaquine (Camoquin)
5. Mefloquine (Lariam)
6. Pyrimethamine (Daraprim)
7. Primaquine
8. artemisinin (artemisinine)
9. Artesunate
10. Quinine (Quinson)

Related Therapies and Procedures

1. Therapeutics
2. Chemoprevention
3. Drug Therapy (Chemotherapy)
4. Aftercare (After-Treatment)
5. Radiotherapy