HOMEPRODUCTSSERVICESCOMPANYCONTACTFAQResearchDictionaryPharmaMobileSign Up FREE or Login

pyroglutamyl- (2- propyl)histidyl- prolinamide

structure in first source
Also Known As:
NP 647; NP-647; NP647 cpd; pGlu-(2-propyl)His-ProNH2
Networked: 2 relevant articles (2 outcomes, 2 trials/studies)

Relationship Network

Bio-Agent Context: Research Results

Experts

1. Meena, Chhuttan Lal: 2 articles (06/2011 - 01/2009)
2. Jain, Rahul: 2 articles (06/2011 - 01/2009)
3. Rajput, Satyendra Kumar: 2 articles (06/2011 - 01/2009)
4. Siddiqui, Maqsood Ahmad: 1 article (06/2011)
5. Sharma, Shyam Sunder: 1 article (06/2011)
6. Pant, Aditya Bhushan: 1 article (06/2011)
7. Kumar, Vivek: 1 article (06/2011)
8. Monga, Vikramdeep: 1 article (01/2009)
9. Krishnamoorthy, Srinivasan: 1 article (01/2009)
10. Pawar, Chandrasekhar: 1 article (01/2009)

Related Diseases

1. Ischemia
2. Seizures (Seizure)
3. Epilepsy (Aura)
4. Inflammation
5. Brain Ischemia (Cerebral Ischemia)

Related Drugs and Biologics

1. Pentylenetetrazole (Metrazol)
2. Glutamic Acid (Glutamate)
3. Oxygen
4. Glucose (Dextrose)
5. Ac- Nal(1)- Cpa(2)- Pal(3,6)- Arg(5)- Ala(10)- LHRH
6. PC 12
7. Theophylline (Theon)