HOMEPRODUCTSSERVICESCOMPANYCONTACTFAQResearchDictionaryPharmaMobileSign Up FREE or Login

N-(3-chloro-4-morpholin-4-yl) phenyl-N'-hydroxyimido formamide

structure in first source
Also Known As:
TS-011
Networked: 6 relevant articles (2 outcomes, 3 trials/studies)

Relationship Network

Bio-Agent Context: Research Results

Experts

1. Omura, Tomohiro: 4 articles (11/2010 - 07/2005)
2. Miyata, Noriyuki: 3 articles (12/2007 - 07/2005)
3. Tanaka, Yu: 3 articles (12/2007 - 07/2005)
4. Roman, Richard J: 3 articles (06/2006 - 07/2005)
5. Yoshida, Shigeru: 2 articles (12/2007 - 05/2006)
6. Minagawa, Toshiya: 2 articles (12/2007 - 05/2006)
7. Fukasawa, Misako: 2 articles (12/2007 - 05/2006)
8. Nakaike, Shiro: 2 articles (12/2007 - 05/2006)
9. Okuyama, Shigeru: 2 articles (05/2006 - 07/2005)
10. Harder, David R: 2 articles (05/2006 - 07/2005)

Related Diseases

1. Stroke (Strokes)
2. Intracranial Vasospasm
3. Subarachnoid Hemorrhage (Aneurysmal Subarachnoid Hemorrhage)
4. Middle Cerebral Artery Infarction (Middle Cerebral Artery Syndrome)
5. Hypertension (High Blood Pressure)

Related Drugs and Biologics

1. 20-hydroxy-5,8,11,14-eicosatetraenoic acid
2. Tissue Plasminogen Activator (Alteplase)
3. formamide