HOMEPRODUCTSSERVICESCOMPANYCONTACTFAQResearchDictionaryPharmaMobileSign Up FREE or Login

JM 335

JM149 is the cis congener of JM335; structure given in first source
Also Known As:
JM 149; JM-335; JM149; JM335; cis,trans,cis-(PtCl2(OH)2(c-C6H11NH2)(NH3)); trans-ammine(cyclohexylamine)dichlorodihydroxo-platinum(IV)
Networked: 6 relevant articles (1 outcomes, 0 trials/studies)

Relationship Network

Bio-Agent Context: Research Results

Related Diseases

1. Carcinoma (Carcinomatosis)
2. Plasmacytoma
3. Neoplasms (Cancer)
4. Hypersensitivity (Allergy)

Related Drugs and Biologics

1. Cisplatin (Platino)
2. PC6 extract (PC6)
3. Platinum
4. JM 335
5. Cyclohexylamines
6. tetraplatin (ormaplatin)
7. amminedichloro(cyclohexylamine)platinum(II)
8. satraplatin (JM 216)
9. transplatin
10. DNA (Deoxyribonucleic Acid)

Related Therapies and Procedures

1. Heterologous Transplantation (Xenotransplantation)