HOMEPRODUCTSCOMPANYCONTACTFAQResearchDictionaryPharmaSign Up FREE or Login

chloroquine diphosphate

Also Known As:
N(4)-(7-chloro-4-quinolinyl)-N(1),N(1)-diethyl-1,4-pentanediamine, phosphate (1:2); Resochin; arechin; chingamin phosphate; chloroquine bis(dihydrogenphosphate) dihydrate; chloroquine diphosphate, (+)-isomer; chloroquine diphosphate, (+-)-isomer; chloroquine diphosphate, (-)-isomer; chloroquine phosphate; delagil; khingamin phosphate; unspecified phosphate of chloroquine diphosphate
Networked: 338 relevant articles (21 outcomes, 25 trials/studies)

Relationship Network

Drug Context: Research Results

Experts

1. Bonfá, E: 3 articles (01/2007 - 04/2001)
2. Borba, E F: 3 articles (01/2007 - 04/2001)
3. Gao, Yu: 2 articles (01/2022 - 03/2021)
4. Cai, Ting: 2 articles (09/2021 - 07/2020)
5. Zhang, Shun: 2 articles (09/2021 - 07/2020)
6. Chen, Yan: 2 articles (01/2021 - 01/2020)
7. Cui, Cheng: 2 articles (07/2020 - 01/2020)
8. Li, Haiyan: 2 articles (07/2020 - 01/2020)
9. Liu, Dongyang: 2 articles (07/2020 - 01/2020)
10. Song, Chunli: 2 articles (07/2020 - 01/2020)

Related Diseases

1. COVID-19
2. Malaria
3. Neoplasms (Cancer)
4. Infections
5. Systemic Lupus Erythematosus (Libman-Sacks Disease)

Related Drugs and Biologics

1. Hydroxychloroquine (Plaquenil)
2. Pyrimethamine (Daraprim)
3. Proteins (Proteins, Gene)
4. Chloroquine (Aralen)
5. Antimalarials (Antimalarial Agents)
6. Lopinavir
7. Ritonavir (Norvir)
8. Sulfadoxine (Sulformethoxine)
9. Fluorouracil (Carac)
10. Proguanil (Paludrine)

Related Therapies and Procedures

1. Therapeutics
2. Chemoprevention
3. Aftercare (After-Treatment)
4. Contraindications
5. Spinal Injections