HOMEPRODUCTSSERVICESCOMPANYCONTACTFAQResearchDictionaryPharmaMobileSign Up FREE or Login

hyperforin

a prenylated acylphloroglucinol derivative; bicyclic triketone containing 4 isoprenoid chains; antibiotic component of novoimanine; psychoactive agent in St. John's wort; Russian; structure;
Also Known As:
IDN5706; octahydrohyperforin; tetrahydrohyperforin; 4-hydroxy-6-methyl-1,3,7-tris(3-methyl-2-butenyl)-5-(2-methyl-1-oxopropyl)-6-(4-methyl-3-pentenyl) bicyclo(3.3.1)non-3-ene-2,9-dione
Networked: 58 relevant articles (6 outcomes, 5 trials/studies)

Relationship Network

Bio-Agent Context: Research Results

Experts

1. Garbisa, Spiridione: 6 articles (01/2011 - 09/2004)
2. Schempp, Christoph M: 5 articles (02/2014 - 02/2002)
3. Billard, C: 5 articles (01/2013 - 03/2006)
4. Inestrosa, N C: 4 articles (01/2014 - 11/2006)
5. Dell'Aica, Isabella: 4 articles (01/2008 - 09/2004)
6. Inestrosa, Nibaldo C: 3 articles (04/2015 - 03/2010)
7. Hancke, J L: 3 articles (01/2011 - 11/2006)
8. Kolb, J-P: 3 articles (03/2009 - 03/2006)
9. Kiss, Judit: 3 articles (12/2008 - 02/2002)
10. Quiney, C: 3 articles (09/2006 - 03/2006)

Related Diseases

1. Atopic Dermatitis (Atopic Eczema)
2. Depressive Disorder (Melancholia)
3. Stroke (Strokes)
4. Demyelinating Diseases (Demyelinating Disease)
5. Amnesia (Dissociative Amnesia)

Related Drugs and Biologics

1. Scopolamine (Hyoscine)
2. hypericin
3. Rifampin (Rifampicin)
4. Quercetin
5. Phenobarbital (Luminal)
6. pregnane X receptor
7. irinotecan (Camptosar)
8. Phloroglucinol
9. dicyclohexylamine
10. Peptide Hydrolases (Proteases)

Related Therapies and Procedures

1. Photochemotherapy (Photodynamic Therapy)
2. Injections
3. Drug Therapy (Chemotherapy)